| In ZINC since | Heavy atoms | Benign functionality |
|---|---|---|
| October 31st, 2005 | 26 | Yes |
Popular Name: c1ccc2c(c1)[C@@H](c3ccccc3O2)C[C@]([C@@H]4C[C@H]4C(=O)O)(C(=O)O)N c1ccc2c(c1)[C@@H](c3ccccc3O2)C[C…
| Type pH range | xlogP | Des A‑Pol Apolar desolvation (kcal/mol) | Des Pol Polar desolvation (kcal/mol) | H Don H-bond donors | H Acc H-bond acceptors | Chg Net charge | tPSA (Ų) | MWT Molecular weight (g/mol) | RB Rotatable bonds | DL |
|---|---|---|---|---|---|---|---|---|---|---|
| Ref Reference (pH 7) | 0.75 | -0.76 | -72.7 | 3 | 6 | -1 | 117 | 352.366 | 5 | ↓ |
| Code | Description | Organism Class | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| GRM2-1-E | Metabotropic Glutamate Receptor 2 (cluster #1 Of 2), Eukaryotic | Eukaryotes | 860 | 0.33 | Binding ≤ 10μM |
| GRM3-1-E | Metabotropic Glutamate Receptor 3 (cluster #1 Of 1), Eukaryotic | Eukaryotes | 860 | 0.33 | Binding ≤ 10μM |
| Uniprot | Swissprot | Description | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| GRM2_RAT | P31421 | Metabotropic Glutamate Receptor 2, Rat | 860 | 0.33 | Binding ≤ 1μM |
| GRM3_RAT | P31422 | Metabotropic Glutamate Receptor 3, Rat | 860 | 0.33 | Binding ≤ 1μM |
| GRM2_RAT | P31421 | Metabotropic Glutamate Receptor 2, Rat | 4200 | 0.29 | Binding ≤ 10μM |
| GRM3_RAT | P31422 | Metabotropic Glutamate Receptor 3, Rat | 4200 | 0.29 | Binding ≤ 10μM |
| Description | Species |
|---|---|
| Class C/3 (Metabotropic glutamate/pheromone receptors) | |
| G alpha (i) signalling events |