| In ZINC since | Heavy atoms | Benign functionality |
|---|---|---|
| October 30th, 2005 | 36 | No |
Popular Name: CC(C)[C@H]1C(=O)N[C@@H](Cc2cc(ccc2N1C)NC(=O)/C=C/C=C/c3ccc(cc3)C(F)(F)F)CO CC(C)[C@H]1C(=O)N[C@@H](Cc2cc(cc…
| Type pH range | xlogP | Des A‑Pol Apolar desolvation (kcal/mol) | Des Pol Polar desolvation (kcal/mol) | H Don H-bond donors | H Acc H-bond acceptors | Chg Net charge | tPSA (Ų) | MWT Molecular weight (g/mol) | RB Rotatable bonds | DL |
|---|---|---|---|---|---|---|---|---|---|---|
| Ref Reference (pH 7) | 4.52 | -0.45 | -17.6 | 3 | 6 | 0 | 81 | 501.549 | 7 | ↓ |
| Code | Description | Organism Class | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| KPCA-1-E | Protein Kinase C Alpha (cluster #1 Of 6), Eukaryotic | Eukaryotes | 12 | 0.31 | Binding ≤ 10μM |
| Uniprot | Swissprot | Description | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| KPCA_HUMAN | P17252 | Protein Kinase C Alpha, Human | 11.9 | 0.31 | Binding ≤ 1μM |
| KPCA_HUMAN | P17252 | Protein Kinase C Alpha, Human | 11.9 | 0.31 | Binding ≤ 10μM |
| Description | Species |
|---|---|
| Acetylcholine regulates insulin secretion | |
| Ca2+ pathway | |
| Calmodulin induced events | |
| Depolymerisation of the Nuclear Lamina | |
| Disinhibition of SNARE formation | |
| EGFR Transactivation by Gastrin | |
| G alpha (z) signalling events | |
| HuR stabilizes mRNA | |
| Inactivation, recovery and regulation of the phototransduction cascade | |
| Regulation of KIT signaling | |
| Response to elevated platelet cytosolic Ca2+ | |
| Signaling by SCF-KIT | |
| Syndecan interactions | |
| Trafficking of GluR2-containing AMPA receptors | |
| VEGFR2 mediated cell proliferation | |
| WNT5A-dependent internalization of FZD4 |
