UCSF

This report ranks vendors by which sells the most compounds in your active cart. Click on Download to download all this information in tab delimited format suitable for reading in a spreadsheet program. Click on the vendor name to go to the vendor information page in ZINC. Click on "N available" to focus on this vendor's compounds only. Click on Send Quote Request to compose an email to the vendor. If the supplier code is clickable, it takes you directly to the vendor page for that compound. Click on the ZINC ID to go to the Molecule detail page. Click on the SMILES to perform find analogs of that compounds in ZINC. Hover over the smiles for the molecular structure.

Overview

Default (Public by wolfwang) Default Download

Catalogs to Purchase

Available Catalogs

Ambinter 208 Available Email Quote Request

ZINC ID Supplier Code SMILES (Find Similar) Suppliers Score
Amb11015513 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
Amb11015513 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
Amb11015517 CC(C)CCn1c(c(c2c1ncc(c2)NCc3cccc(c3)OCCO)NC(=O)COC)C(=O)OC
5 Z
Amb11015535 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NCc4cccc(c4)F
5 Z
Amb11015535 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NCc4cccc(c4)F
5 Z
Amb11015545 CCc1ccc(o1)CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
4 Z
Amb11015549 CC(C)CCn1c(c(c2c1ncc(c2)NCc3cc(cc(c3)F)F)NC(=O)COC)C(=O)OC
5 Z
Amb11015557 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11015557 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11015557 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11015557 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11015559 CC(C)Cn1c(c(c2c1ncc(c2)NCc3cc(ccc3F)OC)NC(=O)Cc4ccccc4)C(=O)OC
5 Z
Amb11015577 Cn1c(c(c2c1ncc(c2)NCC3CCCCC3)NC(=O)COC)C(=O)OC
6 Z
Amb11015585 CCC(CC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCOC4
6 Z
Amb11015585 CCC(CC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCOC4
6 Z
Amb11015606 Cn1c(c(c2c1ncc(c2)NCc3cnn(c3)c4ccccc4)NC(=O)COC)C(=O)OC
5 Z
Amb11015653 CCn1c(c(c2c1ncc(c2)N[C@@H](C)C(C)(C)O)NC(=O)[C@@H]3CCOC3)C(=O)OC
6 Z
Amb11015653 CCn1c(c(c2c1ncc(c2)N[C@@H](C)C(C)(C)O)NC(=O)[C@H]3CCOC3)C(=O)OC
6 Z
Amb11015653 CCn1c(c(c2c1ncc(c2)N[C@H](C)C(C)(C)O)NC(=O)[C@@H]3CCOC3)C(=O)OC
6 Z
Amb11015653 CCn1c(c(c2c1ncc(c2)N[C@H](C)C(C)(C)O)NC(=O)[C@H]3CCOC3)C(=O)OC
6 Z
Amb11015669 Cn1c(c(c2c1ncc(c2)NCc3cccc(c3)F)NC(=O)c4ccco4)C(=O)OC
5 Z
Amb11015673 CC(C)CNc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)c3cccnc3
6 Z
Amb11015691 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
Amb11015691 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
Amb11015691 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
Amb11015691 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
Amb11015731 CCCNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
Amb11015745 Cc1ccccc1CNc2cc3c(c(n(c3nc2)CCc4ccc(cc4)OC)C(=O)OC)NC(=O)C
6 Z
Amb11015748 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)C4CC4
6 Z
Amb11015748 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)C4CC4
6 Z
Amb11015757 COCCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)OC)NC(=O)CCc4ccccc4)C(=O)OC
6 Z
Amb11015769 C[C@@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
Amb11015769 C[C@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
Amb11015783 Cc1ccccc1CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
6 Z
Amb11015802 C[C@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11015802 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11015802 C[C@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11015802 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11015817 CC(C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3
6 Z
Amb11015838 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
Amb11015838 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
Amb11015838 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
Amb11015838 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
Amb11015851 Cc1ccc(s1)CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
6 Z
Amb11015879 COCC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3c[nH]c4c3cccc4)NC5CCSCC5
6 Z
Amb11015894 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCSCC3)NC(=O)c4ccoc4)C(=O)OC
5 Z
Amb11015915 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)c4ccco4
6 Z
Amb11015928 C/C=C(\C)/CNc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)C
5 Z
Amb11015929 C[C@@H](CSC)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
5 Z
Amb11015929 C[C@H](CSC)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
5 Z
Amb11015933 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCSCC3)NC(=O)Cc4ccccc4)C(=O)OC
5 Z
Amb11015958 CCCNc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
5 Z
Amb11015958 CCCNc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
5 Z
Amb11015965 C/C(=C\c1ccccc1)/CNc2cc3c(c(n(c3nc2)Cc4ccccc4)C(=O)OC)NC(=O)C5CC5
5 Z
Amb11015966 COCCn1c(c(c2c1ncc(c2)NC[C@@H]3CCC=CC3)NC(=O)CCc4ccccc4)C(=O)OC
5 Z
Amb11015966 COCCn1c(c(c2c1ncc(c2)NC[C@H]3CCC=CC3)NC(=O)CCc4ccccc4)C(=O)OC
5 Z
Amb11015972 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
Amb11015972 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
Amb11015982 C[C@@H](Cc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)COC
6 Z
Amb11015982 C[C@H](Cc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)COC
6 Z
Amb11015988 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C)NCC3CCCCC3
5 Z
Amb11015993 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCCCC4
6 Z
Amb11015993 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCCCC4
6 Z
Amb11015996 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC/C(=C/C)/C
5 Z
Amb11015996 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC/C(=C/C)/C
5 Z
Amb11015996 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC/C(=C/C)/C
3 Z
Amb11015996 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC/C(=C/C)/C
3 Z
Amb11016003 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCSCC4
6 Z
Amb11016003 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCSCC4
6 Z
Amb11016025 CCn1c(c(c2c1ncc(c2)NCc3ccc(c(c3)O)OC)NC(=O)C)C(=O)OC
5 Z
Amb11016071 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
Amb11016071 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
Amb11016095 CC(C)CCn1c(c(c2c1ncc(c2)NCc3c(cccc3Cl)F)NC(=O)COC)C(=O)OC
5 Z
Amb11016104 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
Amb11016104 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
Amb11016113 C[C@@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11016113 C[C@@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11016113 C[C@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11016113 C[C@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11016167 C[C@H](CCNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)c3ccco3)O
6 Z
Amb11016167 C[C@@H](CCNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)c3ccco3)O
6 Z
Amb11016184 CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)OCC)NC(=O)C)C(=O)OC
6 Z
Amb11016188 C[C@@H](CCc1c[nH]c2c1cccc2)Nc3cc4c(c(n(c4nc3)C)C(=O)OC)NC(=O)COC
5 Z
Amb11016188 C[C@H](CCc1c[nH]c2c1cccc2)Nc3cc4c(c(n(c4nc3)C)C(=O)OC)NC(=O)COC
5 Z
Amb11016205 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3ccc(cc3)OC)NCc4ccccc4
5 Z
Amb11016306 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccco3
6 Z
Amb11016306 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccco3
6 Z
Amb11016313 CC(C)CNc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
Amb11016361 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)CCc4ccccc4
6 Z
Amb11016374 C[C@@H](Cc1ccc(cc1)F)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
5 Z
Amb11016374 C[C@H](Cc1ccc(cc1)F)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
5 Z
Amb11016381 Cc1cccc(c1)CNc2cc3c(c(n(c3nc2)CCCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
Amb11016381 Cc1cccc(c1)CNc2cc3c(c(n(c3nc2)CCCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
Amb11016388 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)Cc4ccccc4
6 Z
Amb11016418 C[C@@H](Cc1cccc(c1)OC)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
Only Z
Amb11016418 C[C@H](Cc1cccc(c1)OC)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
Only Z
Amb11016428 C[C@@H](CCC=C(C)C)Nc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
Amb11016428 C[C@H](CCC=C(C)C)Nc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
Amb11016456 C[C@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11016456 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11016456 C[C@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11016456 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11016484 Cn1c(c(c2c1ncc(c2)NCc3cccc(c3F)F)NC(=O)c4ccco4)C(=O)OC
6 Z
Amb11016500 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3ccc(cc3)OC)NCC(C)(C)C
6 Z
Amb11016512 CC(C)CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCOC)NCc3cc(cc(c3)OC)OC
Only Z
Amb11016523 Cn1c(c(c2c1ncc(c2)NCc3cnn(c3)c4ccc(cc4)F)NC(=O)c5ccco5)C(=O)OC
5 Z
Amb11016542 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NC4CCCCCC4)NC(=O)C5CC5
6 Z
Amb11016554 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)C)C(=O)OC
6 Z
Amb11016554 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)C)C(=O)OC
6 Z
Amb11016570 CCOc1ccc(cc1)CNc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)CC(C)C
6 Z
Amb11016572 COCCn1c(c(c2c1ncc(c2)NCc3c(cccc3F)F)NC(=O)CCc4ccccc4)C(=O)OC
3 Z
Amb11016591 CC(C)Cn1c(c(c2c1ncc(c2)NCc3ccccc3OC)NC(=O)c4ccoc4)C(=O)OC
6 Z
Amb11016601 COCCn1c(c(c2c1ncc(c2)NC3CCOCC3)NC(=O)Cc4ccccc4)C(=O)OC
6 Z
Amb11016615 CC(C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
Amb11016640 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3ccc(cc3)OC)NCc4cccc(c4)OC
6 Z
Amb11016670 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NC4CCOCC4)NC(=O)[C@@H]5CCCO5
6 Z
Amb11016670 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NC4CCOCC4)NC(=O)[C@H]5CCCO5
6 Z
Amb11016673 C[C@@H](Cc1ccccc1OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
Amb11016673 C[C@H](Cc1ccccc1OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
Amb11016677 CC(C)CCn1c(c(c2c1ncc(c2)NC3CC[NH+](CC3)C(C)C)NC(=O)c4ccco4)C(=O)OC
6 Z
Amb11016688 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
6 Z
Amb11016688 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
6 Z
Amb11016704 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCCCC3)NC(=O)c4ccoc4)C(=O)OC
6 Z
Amb11016711 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NCc4ccc(cc4)Cl)NC(=O)C5CC5
6 Z
Amb11016728 COC(=O)c1c(c2cc(cnc2n1C[C@@H]3CCCO3)NC4CCCCC4)NC(=O)c5ccccc5
6 Z
Amb11016728 COC(=O)c1c(c2cc(cnc2n1C[C@H]3CCCO3)NC4CCCCC4)NC(=O)c5ccccc5
6 Z
Amb11016733 CC(C)CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)F)NC(=O)COC)C(=O)OC
5 Z
Amb11016768 COCCn1c(c(c2c1ncc(c2)NCc3ccccc3OC)NC(=O)Cc4ccccc4)C(=O)OC
6 Z
Amb11016774 CC(C)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)COC
5 Z
Amb11016791 Cc1cc(cc(c1)CNc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)c4ccco4)C
5 Z
Amb11016799 CC(C)Cn1c(c(c2c1ncc(c2)NCc3cc(cc(c3)F)F)NC(=O)Cc4ccccc4)C(=O)OC
6 Z
Amb11016801 C[C@H](COC)Nc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)Cc3ccccc3
Only Z
Amb11016801 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)Cc3ccccc3
Only Z
Amb11016823 CC(C)CNc1cc2c(c(n(c2nc1)CCc3ccccn3)C(=O)OC)NC(=O)C4CCC4
6 Z
Amb11016863 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
Amb11016863 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
Amb11016880 Cn1c(c(c2c1ncc(c2)NC3C4CC5CC(C4)CC3C5)NC(=O)CCc6ccccc6)C(=O)OC
3 Z
Amb11016890 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C)NCc3ccc(cc3F)F
5 Z
Amb11016904 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11016904 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11016904 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11016904 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
Amb11016914 CC(C)CCn1c(c(c2c1ncc(c2)NC3CCCC3)NC(=O)c4ccco4)C(=O)OC
6 Z
Amb11016929 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3c[nH]c4c3cccc4)NC5CCC5
6 Z
Amb11016942 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NCC4CCCCC4
5 Z
Amb11016942 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NCC4CCCCC4
5 Z
Amb11016949 CC(C)CCn1c(c(c2c1ncc(c2)NCc3ccc(c(c3)OC)OC)NC(=O)C)C(=O)OC
5 Z
Amb11016973 COC(=O)c1c(c2cc(cnc2n1Cc3ccco3)NC4CCOCC4)NC(=O)c5ccccc5
5 Z
Amb11016987 CCOc1ccc(cc1)CNc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)c4ccco4
5 Z
Amb11016998 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)C
5 Z
Amb11016998 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)C
5 Z
Amb11017010 CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)C)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
Amb11017010 CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)C)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
Amb11017013 Cn1c(c(c2c1ncc(c2)NC3CCCC3)NC(=O)COC)C(=O)OC
5 Z
Amb11017016 CC(C)Cn1c(c(c2c1ncc(c2)NCCCc3ccccc3)NC(=O)c4cccnc4)C(=O)OC
6 Z
Amb11017031 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccn4)C(=O)OC)NC(=O)C5CCC5
6 Z
Amb11017039 Cc1c(cnn1C)CNc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)c4ccco4
5 Z
Amb11017043 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3
6 Z
Amb11017043 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3
6 Z
Amb11017046 Cc1c(c(ccc1CNc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C)OC)C
5 Z
Amb11017046 Cc1c(c(ccc1CNc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C)OC)C
5 Z
Amb11017051 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCN(CC4)C(=O)C
6 Z
Amb11017051 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCN(CC4)C(=O)C
6 Z
Amb11017054 CCCNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)COC
Only Z
Amb11017068 CCn1c(c(c2c1ncc(c2)NC3CCCCCC3)NC(=O)[C@@H]4CCOC4)C(=O)OC
5 Z
Amb11017068 CCn1c(c(c2c1ncc(c2)NC3CCCCCC3)NC(=O)[C@H]4CCOC4)C(=O)OC
5 Z
Amb11017093 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)Cc4ccccc4
6 Z
Amb11017101 C[C@H](CNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3)c4ccccc4
6 Z
Amb11017101 C[C@@H](CNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3)c4ccccc4
6 Z
Amb11017111 CC[C@@H](C)CNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)COC
5 Z
Amb11017111 CC[C@H](C)CNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)COC
5 Z
Amb11017115 Cc1c(cnn1C)CNc2cc3c(c(n(c3nc2)Cc4ccccc4)C(=O)OC)NC(=O)C5CC5
3 Z
Amb11017121 CCn1c(c(c2c1ncc(c2)N[C@@H]3CCc4ccccc4C3)NC(=O)C)C(=O)OC
6 Z
Amb11017121 CCn1c(c(c2c1ncc(c2)N[C@H]3CCc4ccccc4C3)NC(=O)C)C(=O)OC
6 Z
Amb11017150 C[C@@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
Amb11017150 C[C@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
Amb11017191 Cn1c(c(c2c1ncc(c2)NCC3CCCCC3)NC(=O)COc4ccccc4)C(=O)OC
5 Z
Amb11017193 C[C@@H](CO)Nc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
Amb11017193 C[C@H](CO)Nc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
Amb11017223 C[C@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4)O
3 Z
Amb11017223 C[C@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4)O
3 Z
Amb11017223 C[C@@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4)O
3 Z
Amb11017223 C[C@@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4)O
3 Z
Amb11017233 CC[C@@H](C)CNc1cc2c(c(n(c2nc1)CCc3c[nH]c4c3cccc4)C(=O)OC)NC(=O)C
6 Z
Amb11017233 CC[C@H](C)CNc1cc2c(c(n(c2nc1)CCc3c[nH]c4c3cccc4)C(=O)OC)NC(=O)C
6 Z
Amb11017249 C[C@@H](Cc1cccc(c1)C(F)(F)F)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
Amb11017249 C[C@H](Cc1cccc(c1)C(F)(F)F)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
Amb11017284 C[C@H](CCNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3)c4ccccc4
6 Z
Amb11017284 C[C@@H](CCNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3)c4ccccc4
6 Z
Amb11017286 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11017286 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11017286 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
Amb11017286 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
Amb11017298 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
6 Z
Amb11017298 CC[C@H](C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
6 Z
Amb11017315 CCn1c(c(c2c1ncc(c2)NC3CCCCC3)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
Amb11017315 CCn1c(c(c2c1ncc(c2)NC3CCCCC3)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
Amb11017322 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3
6 Z
Amb11017322 CC[C@H](C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3
6 Z
Amb11017323 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCCC4
4 Z
Amb11017323 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCCC4
4 Z
Amb11017323 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCCC4
4 Z
Amb11017323 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCCC4
4 Z
Amb11017339 Cc1ccc(o1)CNc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)CC(C)C
6 Z
Amb11017381 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccc(cc3)OC
6 Z
Amb11017381 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccc(cc3)OC
6 Z
Amb11017399 Cn1c(c(c2c1ncc(c2)NC/C=C/c3ccccc3OC)NC(=O)COC)C(=O)OC
6 Z
Amb11017418 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCN(CC3)C(=O)C)NC(=O)Cc4ccccc4)C(=O)OC
6 Z

eMolecules 201 Available Email Quote Request

ZINC ID Supplier Code SMILES (Find Similar) Suppliers Score
20410148 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
20410148 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
20410244 CC(C)CCn1c(c(c2c1ncc(c2)NCc3cccc(c3)OCCO)NC(=O)COC)C(=O)OC
5 Z
20410754 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NCc4cccc(c4)F
5 Z
20410754 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NCc4cccc(c4)F
5 Z
20411016 CCc1ccc(o1)CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
4 Z
20411122 CC(C)CCn1c(c(c2c1ncc(c2)NCc3cc(cc(c3)F)F)NC(=O)COC)C(=O)OC
5 Z
20411294 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20411294 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20411294 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20411294 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20411338 CC(C)Cn1c(c(c2c1ncc(c2)NCc3cc(ccc3F)OC)NC(=O)Cc4ccccc4)C(=O)OC
5 Z
20411826 Cn1c(c(c2c1ncc(c2)NCC3CCCCC3)NC(=O)COC)C(=O)OC
6 Z
20411992 CCC(CC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCOC4
6 Z
20411992 CCC(CC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCOC4
6 Z
20412488 Cn1c(c(c2c1ncc(c2)NCc3cnn(c3)c4ccccc4)NC(=O)COC)C(=O)OC
5 Z
20413690 CCn1c(c(c2c1ncc(c2)N[C@@H](C)C(C)(C)O)NC(=O)[C@@H]3CCOC3)C(=O)OC
6 Z
20413690 CCn1c(c(c2c1ncc(c2)N[C@@H](C)C(C)(C)O)NC(=O)[C@H]3CCOC3)C(=O)OC
6 Z
20413690 CCn1c(c(c2c1ncc(c2)N[C@H](C)C(C)(C)O)NC(=O)[C@@H]3CCOC3)C(=O)OC
6 Z
20413690 CCn1c(c(c2c1ncc(c2)N[C@H](C)C(C)(C)O)NC(=O)[C@H]3CCOC3)C(=O)OC
6 Z
20413936 Cn1c(c(c2c1ncc(c2)NCc3cccc(c3)F)NC(=O)c4ccco4)C(=O)OC
5 Z
20414038 CC(C)CNc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)c3cccnc3
6 Z
20414438 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
20414438 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
20414438 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
20414438 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
20414514 CCOC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)Cc4ccccc4)C(=O)OC)NC(=O)C5CC5
5 Z
20415464 CCCNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
20415902 Cc1ccccc1CNc2cc3c(c(n(c3nc2)CCc4ccc(cc4)OC)C(=O)OC)NC(=O)C
6 Z
20415934 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)C4CC4
6 Z
20415934 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)C4CC4
6 Z
20416148 COCCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)OC)NC(=O)CCc4ccccc4)C(=O)OC
6 Z
20416328 C[C@@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
20416328 C[C@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
20416592 Cc1ccccc1CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
6 Z
20417316 C[C@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20417316 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20417316 C[C@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20417316 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20417616 CC(C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3
6 Z
20418088 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
20418088 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
20418088 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
20418088 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
20418314 Cc1ccc(s1)CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
6 Z
20418768 COCC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3c[nH]c4c3cccc4)NC5CCSCC5
6 Z
20419204 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCSCC3)NC(=O)c4ccoc4)C(=O)OC
5 Z
20419763 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)c4ccco4
6 Z
25990531 C/C=C(\C)/CNc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)C
5 Z
20420143 C[C@@H](CSC)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
5 Z
20420143 C[C@H](CSC)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
5 Z
20420281 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCSCC3)NC(=O)Cc4ccccc4)C(=O)OC
5 Z
20420787 CCCNc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
5 Z
20420787 CCCNc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
5 Z
25990647 C/C(=C\c1ccccc1)/CNc2cc3c(c(n(c3nc2)Cc4ccccc4)C(=O)OC)NC(=O)C5CC5
5 Z
20421213 COCCn1c(c(c2c1ncc(c2)NC[C@@H]3CCC=CC3)NC(=O)CCc4ccccc4)C(=O)OC
5 Z
20421213 COCCn1c(c(c2c1ncc(c2)NC[C@H]3CCC=CC3)NC(=O)CCc4ccccc4)C(=O)OC
5 Z
20421327 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
20421327 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
20421689 C[C@@H](Cc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)COC
6 Z
20421689 C[C@H](Cc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)COC
6 Z
20421785 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C)NCC3CCCCC3
5 Z
20421863 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCCCC4
6 Z
20421863 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCCCC4
6 Z
25990729 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC/C(=C/C)/C
5 Z
25990729 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC/C(=C/C)/C
5 Z
25990729 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC/C(=C/C)/C
3 Z
25990729 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC/C(=C/C)/C
3 Z
20422079 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCSCC4
6 Z
20422079 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCSCC4
6 Z
20422723 CCn1c(c(c2c1ncc(c2)NCc3ccc(c(c3)O)OC)NC(=O)C)C(=O)OC
5 Z
20424105 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
20424105 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
20424815 CC(C)CCn1c(c(c2c1ncc(c2)NCc3c(cccc3Cl)F)NC(=O)COC)C(=O)OC
5 Z
20425047 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
20425047 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
20425371 C[C@@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20425371 C[C@@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20425371 C[C@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20425371 C[C@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20426647 C[C@H](CCNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)c3ccco3)O
6 Z
20426647 C[C@@H](CCNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)c3ccco3)O
6 Z
20427129 CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)OCC)NC(=O)C)C(=O)OC
6 Z
20427225 C[C@@H](CCc1c[nH]c2c1cccc2)Nc3cc4c(c(n(c4nc3)C)C(=O)OC)NC(=O)COC
5 Z
20427225 C[C@H](CCc1c[nH]c2c1cccc2)Nc3cc4c(c(n(c4nc3)C)C(=O)OC)NC(=O)COC
5 Z
20427671 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3ccc(cc3)OC)NCc4ccccc4
5 Z
20430553 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccco3
6 Z
20430553 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccco3
6 Z
20430779 CC(C)CNc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
20432265 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)CCc4ccccc4
6 Z
20432593 C[C@@H](Cc1ccc(cc1)F)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
5 Z
20432593 C[C@H](Cc1ccc(cc1)F)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
5 Z
20432691 Cc1cccc(c1)CNc2cc3c(c(n(c3nc2)CCCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
20432691 Cc1cccc(c1)CNc2cc3c(c(n(c3nc2)CCCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
20432883 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)Cc4ccccc4
6 Z
20434081 C[C@@H](CCC=C(C)C)Nc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
20434081 C[C@H](CCC=C(C)C)Nc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
20434837 C[C@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20434837 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20434837 C[C@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20434837 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20435701 Cn1c(c(c2c1ncc(c2)NCc3cccc(c3F)F)NC(=O)c4ccco4)C(=O)OC
6 Z
20435985 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3ccc(cc3)OC)NCC(C)(C)C
6 Z
20436673 Cn1c(c(c2c1ncc(c2)NCc3cnn(c3)c4ccc(cc4)F)NC(=O)c5ccco5)C(=O)OC
5 Z
20437083 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NC4CCCCCC4)NC(=O)C5CC5
6 Z
20437455 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)C)C(=O)OC
6 Z
20437455 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)C)C(=O)OC
6 Z
20437763 CCOc1ccc(cc1)CNc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)CC(C)C
6 Z
20438321 CC(C)Cn1c(c(c2c1ncc(c2)NCc3ccccc3OC)NC(=O)c4ccoc4)C(=O)OC
6 Z
20438487 COCCn1c(c(c2c1ncc(c2)NC3CCOCC3)NC(=O)Cc4ccccc4)C(=O)OC
6 Z
20438875 CC(C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
20439859 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3ccc(cc3)OC)NCc4cccc(c4)OC
6 Z
20440787 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NC4CCOCC4)NC(=O)[C@@H]5CCCO5
6 Z
20440787 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NC4CCOCC4)NC(=O)[C@H]5CCCO5
6 Z
20440887 C[C@@H](Cc1ccccc1OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
20440887 C[C@H](Cc1ccccc1OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
20440997 CC(C)CCn1c(c(c2c1ncc(c2)NC3CC[NH+](CC3)C(C)C)NC(=O)c4ccco4)C(=O)OC
6 Z
20441441 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
6 Z
20441441 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
6 Z
20442005 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCCCC3)NC(=O)c4ccoc4)C(=O)OC
6 Z
20442155 COC(=O)c1c(c2cc(cnc2n1Cc3ccccc3)NCc4ccc(cc4)Cl)NC(=O)C5CC5
6 Z
20442481 COC(=O)c1c(c2cc(cnc2n1C[C@@H]3CCCO3)NC4CCCCC4)NC(=O)c5ccccc5
6 Z
20442481 COC(=O)c1c(c2cc(cnc2n1C[C@H]3CCCO3)NC4CCCCC4)NC(=O)c5ccccc5
6 Z
20442527 CC(C)CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)F)NC(=O)COC)C(=O)OC
5 Z
20443343 COCCn1c(c(c2c1ncc(c2)NCc3ccccc3OC)NC(=O)Cc4ccccc4)C(=O)OC
6 Z
20443549 CC(C)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)COC
5 Z
20443887 Cc1cc(cc(c1)CNc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)c4ccco4)C
5 Z
20444149 CC(C)Cn1c(c(c2c1ncc(c2)NCc3cc(cc(c3)F)F)NC(=O)Cc4ccccc4)C(=O)OC
6 Z
20444925 CC(C)CNc1cc2c(c(n(c2nc1)CCc3ccccn3)C(=O)OC)NC(=O)C4CCC4
6 Z
20445925 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
20445925 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
20446399 Cn1c(c(c2c1ncc(c2)NC3C4CC5CC(C4)CC3C5)NC(=O)CCc6ccccc6)C(=O)OC
3 Z
20446645 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C)NCc3ccc(cc3F)F
5 Z
20447093 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20447093 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20447093 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20447093 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
20447317 CC(C)CCn1c(c(c2c1ncc(c2)NC3CCCC3)NC(=O)c4ccco4)C(=O)OC
6 Z
20447791 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3c[nH]c4c3cccc4)NC5CCC5
6 Z
20448171 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NCC4CCCCC4
5 Z
20448171 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NCC4CCCCC4
5 Z
20448311 CC(C)CCn1c(c(c2c1ncc(c2)NCc3ccc(c(c3)OC)OC)NC(=O)C)C(=O)OC
5 Z
20448883 COC(=O)c1c(c2cc(cnc2n1Cc3ccco3)NC4CCOCC4)NC(=O)c5ccccc5
5 Z
20449259 CCOc1ccc(cc1)CNc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)c4ccco4
5 Z
20449429 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)C
5 Z
20449429 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)C
5 Z
20449751 CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)C)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
20449751 CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)C)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
20449861 Cn1c(c(c2c1ncc(c2)NC3CCCC3)NC(=O)COC)C(=O)OC
5 Z
20450007 CC(C)Cn1c(c(c2c1ncc(c2)NCCCc3ccccc3)NC(=O)c4cccnc4)C(=O)OC
6 Z
20450549 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccn4)C(=O)OC)NC(=O)C5CCC5
6 Z
20450851 Cc1c(cnn1C)CNc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)c4ccco4
5 Z
20451015 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3
6 Z
20451015 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3
6 Z
20451177 Cc1c(c(ccc1CNc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C)OC)C
5 Z
20451177 Cc1c(c(ccc1CNc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C)OC)C
5 Z
20451415 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCN(CC4)C(=O)C
6 Z
20451415 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCN(CC4)C(=O)C
6 Z
20452031 CCn1c(c(c2c1ncc(c2)NC3CCCCCC3)NC(=O)[C@@H]4CCOC4)C(=O)OC
5 Z
20452031 CCn1c(c(c2c1ncc(c2)NC3CCCCCC3)NC(=O)[C@H]4CCOC4)C(=O)OC
5 Z
20452827 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)Cc4ccccc4
6 Z
20453001 C[C@H](CNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3)c4ccccc4
6 Z
20453001 C[C@@H](CNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3)c4ccccc4
6 Z
20453299 CC[C@@H](C)CNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)COC
5 Z
20453299 CC[C@H](C)CNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)COC
5 Z
20453463 CCn1c(c(c2c1ncc(c2)N[C@@H]3CCc4ccccc4C3)NC(=O)C)C(=O)OC
6 Z
20453463 CCn1c(c(c2c1ncc(c2)N[C@H]3CCc4ccccc4C3)NC(=O)C)C(=O)OC
6 Z
20454381 C[C@@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
20454381 C[C@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
20455251 Cn1c(c(c2c1ncc(c2)NCC3CCCCC3)NC(=O)COc4ccccc4)C(=O)OC
5 Z
20455255 C[C@@H](CO)Nc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
20455255 C[C@H](CO)Nc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
20455965 C[C@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4)O
3 Z
20455965 C[C@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4)O
3 Z
20455965 C[C@@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4)O
3 Z
20455965 C[C@@H](CCNc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4)O
3 Z
20456321 CC[C@@H](C)CNc1cc2c(c(n(c2nc1)CCc3c[nH]c4c3cccc4)C(=O)OC)NC(=O)C
6 Z
20456321 CC[C@H](C)CNc1cc2c(c(n(c2nc1)CCc3c[nH]c4c3cccc4)C(=O)OC)NC(=O)C
6 Z
20456709 C[C@@H](Cc1cccc(c1)C(F)(F)F)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
20456709 C[C@H](Cc1cccc(c1)C(F)(F)F)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)C
6 Z
20457561 C[C@H](CCNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3)c4ccccc4
6 Z
20457561 C[C@@H](CCNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)CCc3ccccc3)c4ccccc4
6 Z
20457625 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20457625 C[C@@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20457625 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
20457625 C[C@H](CC(C)C)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
20458031 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
6 Z
20458031 CC[C@H](C)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
6 Z
20458585 CCn1c(c(c2c1ncc(c2)NC3CCCCC3)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
20458585 CCn1c(c(c2c1ncc(c2)NC3CCCCC3)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
20458637 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3
6 Z
20458637 CC[C@H](C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3
6 Z
20458661 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCCC4
4 Z
20458661 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCCC4
4 Z
20458661 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCCC4
4 Z
20458661 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCCC4
4 Z
20459009 Cc1ccc(o1)CNc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)CC(C)C
6 Z
20459979 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccc(cc3)OC
6 Z
20459979 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccc(cc3)OC
6 Z
25994763 Cn1c(c(c2c1ncc(c2)NC/C=C/c3ccccc3OC)NC(=O)COC)C(=O)OC
6 Z
20460783 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCN(CC3)C(=O)C)NC(=O)Cc4ccccc4)C(=O)OC
6 Z

Molport 196 Available Email Quote Request

ZINC ID Supplier Code SMILES (Find Similar) Suppliers Score
MolPort-004-979-185 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
MolPort-004-979-185 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
MolPort-004-979-189 CC(C)CCn1c(c(c2c1ncc(c2)NCc3cccc(c3)OCCO)NC(=O)COC)C(=O)OC
5 Z
MolPort-004-979-207 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NCc4cccc(c4)F
5 Z
MolPort-004-979-207 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NCc4cccc(c4)F
5 Z
MolPort-004-979-221 CC(C)CCn1c(c(c2c1ncc(c2)NCc3cc(cc(c3)F)F)NC(=O)COC)C(=O)OC
5 Z
MolPort-004-979-229 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-229 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C[C@@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-229 CC[C@@H](C)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-229 CC[C@H](C)Nc1cc2c(c(n(c2nc1)C[C@H]3CCCO3)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-231 CC(C)Cn1c(c(c2c1ncc(c2)NCc3cc(ccc3F)OC)NC(=O)Cc4ccccc4)C(=O)OC
5 Z
MolPort-004-979-249 Cn1c(c(c2c1ncc(c2)NCC3CCCCC3)NC(=O)COC)C(=O)OC
6 Z
MolPort-004-979-257 CCC(CC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCOC4
6 Z
MolPort-004-979-257 CCC(CC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCOC4
6 Z
MolPort-004-979-278 Cn1c(c(c2c1ncc(c2)NCc3cnn(c3)c4ccccc4)NC(=O)COC)C(=O)OC
5 Z
MolPort-004-979-325 CCn1c(c(c2c1ncc(c2)N[C@@H](C)C(C)(C)O)NC(=O)[C@@H]3CCOC3)C(=O)OC
6 Z
MolPort-004-979-325 CCn1c(c(c2c1ncc(c2)N[C@@H](C)C(C)(C)O)NC(=O)[C@H]3CCOC3)C(=O)OC
6 Z
MolPort-004-979-325 CCn1c(c(c2c1ncc(c2)N[C@H](C)C(C)(C)O)NC(=O)[C@@H]3CCOC3)C(=O)OC
6 Z
MolPort-004-979-325 CCn1c(c(c2c1ncc(c2)N[C@H](C)C(C)(C)O)NC(=O)[C@H]3CCOC3)C(=O)OC
6 Z
MolPort-004-979-341 Cn1c(c(c2c1ncc(c2)NCc3cccc(c3)F)NC(=O)c4ccco4)C(=O)OC
5 Z
MolPort-004-979-345 CC(C)CNc1cc2c(c(n(c2nc1)CC(C)C)C(=O)OC)NC(=O)c3cccnc3
6 Z
MolPort-004-979-363 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-363 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-363 C[C@@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-363 C[C@H](CCn1cccn1)Nc2cc3c(c(n(c3nc2)C[C@H]4CCCO4)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-367 CCOC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)Cc4ccccc4)C(=O)OC)NC(=O)C5CC5
5 Z
MolPort-004-979-403 CCCNc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
MolPort-004-979-418 Cc1ccccc1CNc2cc3c(c(n(c3nc2)CCc4ccc(cc4)OC)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-421 C[C@@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)C4CC4
6 Z
MolPort-004-979-421 C[C@H](CC(C)(C)O)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)C4CC4
6 Z
MolPort-004-979-430 COCCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)OC)NC(=O)CCc4ccccc4)C(=O)OC
6 Z
MolPort-004-979-442 C[C@@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-442 C[C@H](CCc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
MolPort-004-979-456 Cc1ccccc1CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
6 Z
MolPort-004-979-477 C[C@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
MolPort-004-979-477 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
MolPort-004-979-477 C[C@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
MolPort-004-979-477 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)Cc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
MolPort-004-979-492 CC(C)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)c3ccco3
6 Z
MolPort-004-979-513 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
MolPort-004-979-513 CCn1c(c(c2c1ncc(c2)N[C@@H](C)Cc3ccccc3F)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
MolPort-004-979-513 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)[C@@H]4CCOC4)C(=O)OC
6 Z
MolPort-004-979-513 CCn1c(c(c2c1ncc(c2)N[C@H](C)Cc3ccccc3F)NC(=O)[C@H]4CCOC4)C(=O)OC
6 Z
MolPort-004-979-526 Cc1ccc(s1)CNc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4cccnc4
6 Z
MolPort-004-979-554 COCC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3c[nH]c4c3cccc4)NC5CCSCC5
6 Z
MolPort-004-979-569 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCSCC3)NC(=O)c4ccoc4)C(=O)OC
5 Z
MolPort-004-979-590 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)C)C(=O)OC)NC(=O)c4ccco4
6 Z
MolPort-004-979-603 C/C=C(\C)/CNc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)C
5 Z
MolPort-004-979-604 C[C@@H](CSC)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
5 Z
MolPort-004-979-604 C[C@H](CSC)Nc1cc2c(c(n(c2nc1)CCc3ccc(cc3)OC)C(=O)OC)NC(=O)COC
5 Z
MolPort-004-979-608 CC(C)Cn1c(c(c2c1ncc(c2)NC3CCSCC3)NC(=O)Cc4ccccc4)C(=O)OC
5 Z
MolPort-004-979-633 CCCNc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
5 Z
MolPort-004-979-633 CCCNc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
5 Z
MolPort-004-979-640 C/C(=C\c1ccccc1)/CNc2cc3c(c(n(c3nc2)Cc4ccccc4)C(=O)OC)NC(=O)C5CC5
5 Z
MolPort-004-979-641 COCCn1c(c(c2c1ncc(c2)NC[C@@H]3CCC=CC3)NC(=O)CCc4ccccc4)C(=O)OC
5 Z
MolPort-004-979-641 COCCn1c(c(c2c1ncc(c2)NC[C@H]3CCC=CC3)NC(=O)CCc4ccccc4)C(=O)OC
5 Z
MolPort-004-979-647 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
MolPort-004-979-647 CC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
MolPort-004-979-657 C[C@@H](Cc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)COC
6 Z
MolPort-004-979-657 C[C@H](Cc1ccc(cc1)OC)Nc2cc3c(c(n(c3nc2)CCC(C)C)C(=O)OC)NC(=O)COC
6 Z
MolPort-004-979-663 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C)NCC3CCCCC3
5 Z
MolPort-004-979-668 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCCCC4
6 Z
MolPort-004-979-668 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCCCC4
6 Z
MolPort-004-979-671 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC/C(=C/C)/C
5 Z
MolPort-004-979-671 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC/C(=C/C)/C
5 Z
MolPort-004-979-671 CC[C@@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC/C(=C/C)/C
3 Z
MolPort-004-979-671 CC[C@H](C)C(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC/C(=C/C)/C
3 Z
MolPort-004-979-678 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@@H]3CCCO3)NC4CCSCC4
6 Z
MolPort-004-979-678 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)C[C@H]3CCCO3)NC4CCSCC4
6 Z
MolPort-004-979-701 CCn1c(c(c2c1ncc(c2)NCc3ccc(c(c3)O)OC)NC(=O)C)C(=O)OC
5 Z
MolPort-004-979-747 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
MolPort-004-979-747 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)CCOC)C(=O)OC)NC(=O)Cc3ccccc3
6 Z
MolPort-004-979-772 CC(C)CCn1c(c(c2c1ncc(c2)NCc3c(cccc3Cl)F)NC(=O)COC)C(=O)OC
5 Z
MolPort-004-979-781 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
MolPort-004-979-781 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
MolPort-004-979-791 C[C@@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
MolPort-004-979-791 C[C@@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
MolPort-004-979-791 C[C@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
MolPort-004-979-791 C[C@H](C(C)(C)O)Nc1cc2c(c(n(c2nc1)CCCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
MolPort-004-979-845 C[C@H](CCNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)c3ccco3)O
6 Z
MolPort-004-979-845 C[C@@H](CCNc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)c3ccco3)O
6 Z
MolPort-004-979-862 CCn1c(c(c2c1ncc(c2)NCc3ccc(cc3)OCC)NC(=O)C)C(=O)OC
6 Z
MolPort-004-979-866 C[C@@H](CCc1c[nH]c2c1cccc2)Nc3cc4c(c(n(c4nc3)C)C(=O)OC)NC(=O)COC
5 Z
MolPort-004-979-866 C[C@H](CCc1c[nH]c2c1cccc2)Nc3cc4c(c(n(c4nc3)C)C(=O)OC)NC(=O)COC
5 Z
MolPort-004-979-883 CC(=O)Nc1c2cc(cnc2n(c1C(=O)OC)CCc3ccc(cc3)OC)NCc4ccccc4
5 Z
MolPort-004-979-989 C[C@@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccco3
6 Z
MolPort-004-979-989 C[C@H](CCO)Nc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)c3ccco3
6 Z
MolPort-004-979-996 CC(C)CNc1cc2c(c(n(c2nc1)C)C(=O)OC)NC(=O)COC
6 Z
MolPort-004-980-044 CC(=O)N1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)CCc4ccccc4
6 Z
MolPort-004-980-057 C[C@@H](Cc1ccc(cc1)F)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
5 Z
MolPort-004-980-057 C[C@H](Cc1ccc(cc1)F)Nc2cc3c(c(n(c3nc2)CC(C)C)C(=O)OC)NC(=O)c4ccoc4
5 Z
MolPort-004-980-064 Cc1cccc(c1)CNc2cc3c(c(n(c3nc2)CCCc4ccccc4)C(=O)OC)NC(=O)[C@@H]5CCOC5
6 Z
MolPort-004-980-064 Cc1cccc(c1)CNc2cc3c(c(n(c3nc2)CCCc4ccccc4)C(=O)OC)NC(=O)[C@H]5CCOC5
6 Z
MolPort-004-980-071 CCC[NH+]1CCC(CC1)Nc2cc3c(c(n(c3nc2)CCOC)C(=O)OC)NC(=O)Cc4ccccc4
6 Z
MolPort-004-980-111 C[C@@H](CCC=C(C)C)Nc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
MolPort-004-980-111 C[C@H](CCC=C(C)C)Nc1cc2c(c(n(c2nc1)CCC(C)C)C(=O)OC)NC(=O)C
6 Z
MolPort-004-980-139 C[C@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
MolPort-004-980-139 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@@H]4CCCO4
6 Z
MolPort-004-980-139 C[C@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z
MolPort-004-980-139 C[C@@H](COC)Nc1cc2c(c(n(c2nc1)CCc3ccccc3)C(=O)OC)NC(=O)[C@H]4CCCO4
6 Z