This report ranks vendors by which sells the most compounds in your active cart. Click on Download to download all this information in tab delimited format suitable for reading in a spreadsheet program. Click on the vendor name to go to the vendor information page in ZINC. Click on "N available" to focus on this vendor's compounds only. Click on Send Quote Request to compose an email to the vendor. If the supplier code is clickable, it takes you directly to the vendor page for that compound. Click on the ZINC ID to go to the Molecule detail page. Click on the SMILES to perform find analogs of that compounds in ZINC. Hover over the smiles for the molecular structure.
ZINC ID | Supplier Code | SMILES (Find Similar) | Suppliers | Score |
---|---|---|---|---|
POD_88/0779 |
Cc1ccc(c(c1)C)/N=C\2/CC(=O)C(=O)c3c2cccc3
|
6 | Z | |
Z-018419 |
CCCCCOc1ccc(cc1)/N=C/2\C=C(C(=O)c3c2cccc3)[O-]
|
2 | Z | |
M-171067 |
Cc1cc(cc(c1)/N=C/2\C=C(C(=O)c3c2cccc3)[O-])C
|
3 | Z | |
Z-073757 |
Cc1ccc(cc1C)/N=C\2/C=C(C(=O)c3c2cccc3)[O-]
|
6 | Z | |
R-020380 |
CC(C)c1ccc(cc1)/N=C\2/C=C(C(=O)c3c2cccc3)[O-]
|
3 | Z | |
Z-018425 Z-020891 |
c1ccc2cc(ccc2c1)/N=C/3\C=C(C(=O)c4c3cccc4)[O-]
|
2 | Z | |
Z-020889 |
CCCCc1ccc(cc1)/N=C\2/C=C(C(=O)c3c2cccc3)[O-]
|
2 | Z | |
Z-091565 |
c1ccc2c(c1)/C(=N/c3ccc4c5c3cccc5CC4)/C=C(C2=O)[O-]
|
3 | Z | |
POD_68/0039 Z-019858 |
c1ccc(cc1)/N=C\2/CC(=O)C(=O)c3c2cccc3
|
8 | Z | |
Z-020888 |
c1ccc2c(c1)/C(=N/c3cccc(c3)C(=O)[O-])/C=C(C2=O)[O-]
|
2 | Z |
The following compounds are included in the above report:
# | ZINC ID | SMILES (Find Similar) | Score |
---|---|---|---|
1 | 1625324 | Z | |
2 | 1707098 | Z | |
3 | 2981332 | Z | |
4 | 3096113 | Z | |
5 | 3149166 | Z | |
6 | 3666053 | Z | |
7 | 4824878 | Z | |
8 | 5685301 | Z | |
9 | 12445697 | Z | |
10 | 12462190 | Z | |
11 | 13471360 | Z | |
12 | 13858318 | Z | |
13 | 15228375 | Z | |
14 | 16545723 | Z | |
15 | 16639543 | Z | |
16 | 16917131 | Z | |
17 | 18057078 | Z | |
18 | 18096552 | Z | |
19 | 25585608 | Z | |
20 | 25809294 | Z |