| In ZINC since | Heavy atoms | Benign functionality |
|---|---|---|
| October 30th, 2005 | 34 | Yes |
Popular Name: c1cc(ccc1C[C@@H](C(=O)NCCCCCCCCNCCCN)NC(=O)C2CCCCC2)O c1cc(ccc1C[C@@H](C(=O)NCCCCCCCCN…
| Type pH range | xlogP | Des A‑Pol Apolar desolvation (kcal/mol) | Des Pol Polar desolvation (kcal/mol) | H Don H-bond donors | H Acc H-bond acceptors | Chg Net charge | tPSA (Ų) | MWT Molecular weight (g/mol) | RB Rotatable bonds | DL |
|---|---|---|---|---|---|---|---|---|---|---|
| Ref Reference (pH 7) | 3.20 | -8.3 | -117.82 | 8 | 7 | 2 | 122 | 476.706 | 17 | ↓ |
| Code | Description | Organism Class | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| GRIA1-4-E | Glutamate Receptor Ionotropic, AMPA 1 (cluster #4 Of 4), Eukaryotic | Eukaryotes | 78 | 0.29 | Binding ≤ 10μM |
| Uniprot | Swissprot | Description | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| GRIA1_HUMAN | P42261 | Glutamate Receptor Ionotropic, AMPA 1, Human | 240 | 0.27 | Binding ≤ 1μM |
| GRIA1_HUMAN | P42261 | Glutamate Receptor Ionotropic, AMPA 1, Human | 240 | 0.27 | Binding ≤ 10μM |
| Description | Species |
|---|---|
| Activation of AMPA receptors | |
| Trafficking of AMPA receptors | |
| Trafficking of GluR2-containing AMPA receptors | |
| Unblocking of NMDA receptor, glutamate binding and activation |
