| In ZINC since | Heavy atoms | Benign functionality |
|---|---|---|
| October 4th, 2005 | 19 | Yes |
Popular Name: Ketoprofen Ketoprofen
Find On: PubMed — Wikipedia — Google
CAS Numbers: 156604-79-4 , 22071-15-4 , 22161-86-0 , 56105-81-8 , 57469-78-0 , 57495-14-4 , [22071-15-4] , [57469-78-0]
(+-)-3-Benzoyl-alpha-methylbenzeneacetic acid
(+-)-m-Benzoylhydratropic acid
(R)-2-(3-Benzoylphenyl)propanoic acid
15962-46-6; CPD000040181; KETOPROFEN; SAM002264620
2-(3-Benzoyl-phenyl)-propionic acid
2-(3-Benzoylphenyl)propanoic acid
2-(3-Benzoylphenyl)propionic acid
2-(m-Benzoylphenyl)propionic acid
2-[3-(benzoyl)phenyl]propanoic acid
2-[3-(phenylcarbonyl)phenyl]propanoic acid
2-[3-Benzoylphenyl]propionic acid
22071-15-4; C01716; Ketoprofen
22071-15-4; D00132; Ketoprofen (JP16/USP/INN); Orudis (TN)
22071-15-4; Ketoprofen; Prestwick_617
3-BENZOYL-ALPHA-METHYLBENZENEACETIC ACID
57495-14-4; D08103; Ketoprofen sodium; Orudis (TN)
Acide (benzoyl-3-phenyl)-2-propionique
Acide (benzoyl-3-phenyl)-2-propionique [French]
Benzeneacetic acid, 3-benzoyl-.alpha.-methyl-
Benzeneacetic acid, 3-benzoyl-alpha-methyl-
Benzeneacetic acid, 3-benzoyl-alpha-methyl-, (+-)-
CPD000040181; Ketoprofen; SAM002264620
Hydratropic acid, m-benzoyl-, (+-)-
InChI=1/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)
L'Acide (benzoyl-3-phenyl)-2-propionique
Orudis, Oruvail, Ketoflam, Orudis KT, Ketoprofen
| Type pH range | xlogP | Des A‑Pol Apolar desolvation (kcal/mol) | Des Pol Polar desolvation (kcal/mol) | H Don H-bond donors | H Acc H-bond acceptors | Chg Net charge | tPSA (Ų) | MWT Molecular weight (g/mol) | RB Rotatable bonds | DL |
|---|---|---|---|---|---|---|---|---|---|---|
| Ref Reference (pH 7) | 3.59 | 9.65 | -45.69 | 0 | 3 | -1 | 57 | 253.277 | 4 | ↓ |
| Note Type | Comments | Provided By |
|---|---|---|
| biological_use | . | ZereneX Building Blocks |
| ALOGPS_SOLUBILITY | 2.13e-02 g/l | DrugBank-approved |
| MP | 75 - 78 | Enamine Building Blocks |
| MP | 75...78 | Enamine Building Blocks |
| purity | 9.500000000000000e+001 | Enamine Building Blocks TCI |
| Purity | 95% | Fluorochem |
| Purity | 95+% | Matrix Scientific |
| Purity | 97% | APIChem |
| Purity | 98% | Fluorochem |
| biological_use | Analgesic | IBScreen Bioactives |
| Indications | analgesic, arthritis | KeyOrganics Bioactives |
| Indications | analgesic, NSAID | KeyOrganics Bioactives |
| biological_use | Antiinflammatory | IBScreen Bioactives IBScreen Bioactives |
| mechanism | Bradykinin antagonist | IBScreen Bioactives IBScreen Bioactives |
| mechanism | Bradykinin antagonist; Prostaglandin-antagonist | ZereneX Building Blocks |
| Target | COX | Selleck Chemicals |
| Patent Database Links | EP0908186; EP0990637; EP1088550; EP1106175; EP1176140; EP1231209; EP1310488; EP1405646; EP1493439; EP1518551; EP1520590; EP1554936; EP1595936; EP1611884; EP1614421; EP1614431; EP1621188; EP1627644; EP1634584; EP1649857; EP1661583; EP1679301; EP1685843; EP | ChEBI |
| Warnings | IRRITANT | Matrix Scientific |
| mechanism | Leukotriene synthesis inhibitor | IBScreen Bioactives |
| PUBCHEM_SUBSTANCE_COMMENT | NCC_SAMPLE_SUPPLIER : LightBiologicals; NCC_SUPPLIER_STRUCTURE_ID : K-4804 | NIH Clinical Collection via PubChem |
| mechanism | Prostaglandin-antagonist | IBScreen Bioactives |
| UniProt Database Links | S22A7_RAT; SC5AC_HUMAN | ChEBI |
| PUBCHEM_SUBSTANCE_COMMENT | SAMPLE_SUPPLIER: LightBiologicals; SUPPLIER_STRUCTURE_ID: K-4804 | NIH Clinical Collection via PubChem |
| Code | Description | Organism Class | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| IL8-1-E | Interleukin-8 (cluster #1 Of 1), Eukaryotic | Eukaryotes | 20 | 0.57 | Binding ≤ 10μM |
| PGH1-2-E | Cyclooxygenase-1 (cluster #2 Of 6), Eukaryotic | Eukaryotes | 330 | 0.48 | Binding ≤ 10μM |
| PGH1-2-E | Cyclooxygenase-1 (cluster #2 Of 6), Eukaryotic | Eukaryotes | 3400 | 0.40 | Binding ≤ 10μM |
| PGH2-1-E | Cyclooxygenase-2 (cluster #1 Of 8), Eukaryotic | Eukaryotes | 690 | 0.45 | Binding ≤ 10μM |
| PGH2-1-E | Cyclooxygenase-2 (cluster #1 Of 8), Eukaryotic | Eukaryotes | 3400 | 0.40 | Binding ≤ 10μM |
| CXCR1-1-E | Interleukin-8 Receptor A (cluster #1 Of 2), Eukaryotic | Eukaryotes | 34 | 0.55 | Functional ≤ 10μM |
| CXCR2-1-E | C-X-C Chemokine Receptor Type 2 (cluster #1 Of 3), Eukaryotic | Eukaryotes | 34 | 0.55 | Functional ≤ 10μM |
| PGH1-2-E | Cyclooxygenase-1 (cluster #2 Of 2), Eukaryotic | Eukaryotes | 2 | 0.64 | Functional ≤ 10μM |
| PGH2-1-E | Cyclooxygenase-2 (cluster #1 Of 1), Eukaryotic | Eukaryotes | 26 | 0.56 | Functional ≤ 10μM |
| Z50597-12-O | Rattus Norvegicus (cluster #12 Of 12), Other | Other | 200 | 0.49 | Functional ≤ 10μM |
| Uniprot | Swissprot | Description | Affinity (nM) | LE (kcal/mol/atom) | Type |
|---|---|---|---|---|---|
| PGH1_HUMAN | P23219 | Cyclooxygenase-1, Human | 330 | 0.48 | Binding ≤ 1μM |
| PGH2_HUMAN | P35354 | Cyclooxygenase-2, Human | 690 | 0.45 | Binding ≤ 1μM |
| IL8_HUMAN | P10145 | Interleukin-8, Human | 20 | 0.57 | Binding ≤ 1μM |
| PGH1_HUMAN | P23219 | Cyclooxygenase-1, Human | 330 | 0.48 | Binding ≤ 10μM |
| PGH1_BOVIN | O62664 | Cyclooxygenase-1, Bovin | 3400 | 0.40 | Binding ≤ 10μM |
| PGH2_HUMAN | P35354 | Cyclooxygenase-2, Human | 690 | 0.45 | Binding ≤ 10μM |
| PGH2_BOVIN | O62698 | Cyclooxygenase-2, Bovin | 3400 | 0.40 | Binding ≤ 10μM |
| IL8_HUMAN | P10145 | Interleukin-8, Human | 20 | 0.57 | Binding ≤ 10μM |
| PGH1_HUMAN | P23219 | Cyclooxygenase-1, Human | 2 | 0.64 | Functional ≤ 10μM |
| PGH2_HUMAN | P35354 | Cyclooxygenase-2, Human | 26 | 0.56 | Functional ≤ 10μM |
| CXCR1_HUMAN | P25024 | Interleukin-8 Receptor A, Human | 34 | 0.55 | Functional ≤ 10μM |
| CXCR2_HUMAN | P25025 | Interleukin-8 Receptor B, Human | 34 | 0.55 | Functional ≤ 10μM |
| Z50597 | Z50597 | Rattus Norvegicus | 200 | 0.49 | Functional ≤ 10μM |
| Description | Species |
|---|---|
| ATF4 activates genes | |
| Chemokine receptors bind chemokines | |
| COX reactions | |
| G alpha (i) signalling events | |
| Nicotinamide salvaging | |
| Peptide ligand-binding receptors | |
| Senescence-Associated Secretory Phenotype (SASP) | |
| Synthesis of 15-eicosatetraenoic acid derivatives | |
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) |
